C18H28O7 — CID 144887862
tert-butyl 3-[2-[2-[3-(dihydroxymethyl)phenoxy]ethoxy]ethoxy]propanoate (PubChem CID 144887862) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[3-(dihydroxymethyl)phenoxy]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[3-(dihydroxymethyl)phenoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 144887862 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | tert-butyl 3-[2-[2-[3-(dihydroxymethyl)phenoxy]ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOc1cccc(C(O)O)c1 |
| InChI | InChI=1S/C18H28O7/c1-18(2,3)25-16(19)7-8-22-9-10-23-11-12-24-15-6-4-5-14(13-15)17(20)21/h4-6,13,17,20-21H,7-12H2,1-3H3 |
| InChIKey | NTKDHIJXFOWZDW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|