C25H33NO6 — CID 171639903
ethyl 2-[3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]phenyl]-2-phenylacetate (PubChem CID 171639903) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is ethyl 2-[3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]phenyl]-2-phenylacetate.
| Compound Name | ethyl 2-[3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]phenyl]-2-phenylacetate |
|---|---|
| PubChem CID | 171639903 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | ethyl 2-[3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]phenyl]-2-phenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)c1cccc(OCCOCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H33NO6/c1-5-30-23(27)22(19-10-7-6-8-11-19)20-12-9-13-21(18-20)31-17-16-29-15-14-26-24(28)32-25(2,3)4/h6-13,18,22H,5,14-17H2,1-4H3,(H,26,28) |
| InChIKey | HEJYPFZCZFWNKO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|