C19H25FN4O2 — CID 146243082
1-[(4-fluorophenyl)methyl]-5-(3-hydroxypropyl)-3-(4-methylpiperazin-1-yl)pyrazin-2-one (PubChem CID 146243082) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-5-(3-hydroxypropyl)-3-(4-methylpiperazin-1-yl)pyrazin-2-one.
| Compound Name | 1-[(4-fluorophenyl)methyl]-5-(3-hydroxypropyl)-3-(4-methylpiperazin-1-yl)pyrazin-2-one |
|---|---|
| PubChem CID | 146243082 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-5-(3-hydroxypropyl)-3-(4-methylpiperazin-1-yl)pyrazin-2-one |
| SMILES | CN1CCN(c2nc(CCCO)cn(Cc3ccc(F)cc3)c2=O)CC1 |
| InChI | InChI=1S/C19H25FN4O2/c1-22-8-10-23(11-9-22)18-19(26)24(14-17(21-18)3-2-12-25)13-15-4-6-16(20)7-5-15/h4-7,14,25H,2-3,8-13H2,1H3 |
| InChIKey | KGTFEGBBMPTPNG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |