C18H20FN3O2S — CID 175099777
3-[4-[(4-fluorophenyl)methyl]-5-oxo-6-thiomorpholin-4-ylpyrazin-2-yl]propanal (PubChem CID 175099777) has the molecular formula C18H20FN3O2S and a molecular weight of 361.44 g/mol. Its IUPAC name is 3-[4-[(4-fluorophenyl)methyl]-5-oxo-6-thiomorpholin-4-ylpyrazin-2-yl]propanal.
| Compound Name | 3-[4-[(4-fluorophenyl)methyl]-5-oxo-6-thiomorpholin-4-ylpyrazin-2-yl]propanal |
|---|---|
| PubChem CID | 175099777 |
| Molecular Formula | C18H20FN3O2S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-[4-[(4-fluorophenyl)methyl]-5-oxo-6-thiomorpholin-4-ylpyrazin-2-yl]propanal |
| SMILES | O=CCCc1cn(Cc2ccc(F)cc2)c(=O)c(N2CCSCC2)n1 |
| InChI | InChI=1S/C18H20FN3O2S/c19-15-5-3-14(4-6-15)12-22-13-16(2-1-9-23)20-17(18(22)24)21-7-10-25-11-8-21/h3-6,9,13H,1-2,7-8,10-12H2 |
| InChIKey | NMWMAYFXJUKEMS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|