C16H11FN4O3 — CID 136610854
7-[(4-fluorophenyl)methyl]-5,9-dihydroxy-2H-pyrrolo[3,4-g][1,2,4]benzotriazin-8-one (PubChem CID 136610854) has the molecular formula C16H11FN4O3 and a molecular weight of 326.29 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-5,9-dihydroxy-2H-pyrrolo[3,4-g][1,2,4]benzotriazin-8-one.
| Compound Name | 7-[(4-fluorophenyl)methyl]-5,9-dihydroxy-2H-pyrrolo[3,4-g][1,2,4]benzotriazin-8-one |
|---|---|
| PubChem CID | 136610854 |
| Molecular Formula | C16H11FN4O3 |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-5,9-dihydroxy-2H-pyrrolo[3,4-g][1,2,4]benzotriazin-8-one |
| SMILES | O=c1c2c(O)c3n[nH]cnc3c(O)c2cn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H11FN4O3/c17-9-3-1-8(2-4-9)5-21-6-10-11(16(21)24)15(23)13-12(14(10)22)18-7-19-20-13/h1-4,6-7,22-23H,5H2,(H,18,19) |
| InChIKey | OBFUBSDGMFZSGW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|