C19H15FN2O3 — CID 91489906
7-[(4-fluorophenyl)methyl]-5-methoxypyrrolo[3,4-g]quinoline-8,9-diol (PubChem CID 91489906) has the molecular formula C19H15FN2O3 and a molecular weight of 338.34 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-5-methoxypyrrolo[3,4-g]quinoline-8,9-diol.
| Compound Name | 7-[(4-fluorophenyl)methyl]-5-methoxypyrrolo[3,4-g]quinoline-8,9-diol |
|---|---|
| PubChem CID | 91489906 |
| Molecular Formula | C19H15FN2O3 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-5-methoxypyrrolo[3,4-g]quinoline-8,9-diol |
| SMILES | COc1c2cccnc2c(O)c2c(O)n(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C19H15FN2O3/c1-25-18-13-3-2-8-21-16(13)17(23)15-14(18)10-22(19(15)24)9-11-4-6-12(20)7-5-11/h2-8,10,23-24H,9H2,1H3 |
| InChIKey | MGVQMECANWUVNT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |