C24H18FN3O3 — CID 91558422
7-[(4-fluorophenyl)methyl]-5-(2-methoxy-3-pyridinyl)pyrrolo[3,4-g]quinoline-8,9-diol (PubChem CID 91558422) has the molecular formula C24H18FN3O3 and a molecular weight of 415.42 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-5-(2-methoxy-3-pyridinyl)pyrrolo[3,4-g]quinoline-8,9-diol.
| Compound Name | 7-[(4-fluorophenyl)methyl]-5-(2-methoxy-3-pyridinyl)pyrrolo[3,4-g]quinoline-8,9-diol |
|---|---|
| PubChem CID | 91558422 |
| Molecular Formula | C24H18FN3O3 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-5-(2-methoxy-3-pyridinyl)pyrrolo[3,4-g]quinoline-8,9-diol |
| SMILES | COc1ncccc1-c1c2cccnc2c(O)c2c(O)n(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C24H18FN3O3/c1-31-23-17(5-3-11-27-23)19-16-4-2-10-26-21(16)22(29)20-18(19)13-28(24(20)30)12-14-6-8-15(25)9-7-14/h2-11,13,29-30H,12H2,1H3 |
| InChIKey | NHJIAIFZLVHCTM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|