C28H20FN3O7S — CID 91231165
[7-[(4-fluorophenyl)methyl]-8,9-dihydroxypyrrolo[3,4-g]quinolin-5-yl] 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate (PubChem CID 91231165) has the molecular formula C28H20FN3O7S and a molecular weight of 561.55 g/mol. Its IUPAC name is [7-[(4-fluorophenyl)methyl]-8,9-dihydroxypyrrolo[3,4-g]quinolin-5-yl] 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate.
| Compound Name | [7-[(4-fluorophenyl)methyl]-8,9-dihydroxypyrrolo[3,4-g]quinolin-5-yl] 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate |
|---|---|
| PubChem CID | 91231165 |
| Molecular Formula | C28H20FN3O7S |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.10 |
| IUPAC Name | [7-[(4-fluorophenyl)methyl]-8,9-dihydroxypyrrolo[3,4-g]quinolin-5-yl] 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)Oc1c2cccnc2c(O)c2c(O)n(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C28H20FN3O7S/c29-17-9-7-16(8-10-17)14-31-15-21-22(28(31)36)24(33)23-20(6-3-11-30-23)25(21)39-40(37,38)13-12-32-26(34)18-4-1-2-5-19(18)27(32)35/h1-11,15,33,36H,12-14H2 |
| InChIKey | SHEMRFBTEXLKBB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|