C30H34FN8O+ — CID 153362988
[(2R)-2-(4-fluorophenyl)cyclopropyl]methylidene-[3-[6-(4-methylpiperazin-1-yl)-5-oxo-4-[4-(triazol-1-yl)phenyl]pyrazin-2-yl]propyl]azanium (PubChem CID 153362988) has the molecular formula C30H34FN8O+ and a molecular weight of 541.66 g/mol. Its IUPAC name is [(2R)-2-(4-fluorophenyl)cyclopropyl]methylidene-[3-[6-(4-methylpiperazin-1-yl)-5-oxo-4-[4-(triazol-1-yl)phenyl]pyrazin-2-yl]propyl]azanium.
| Compound Name | [(2R)-2-(4-fluorophenyl)cyclopropyl]methylidene-[3-[6-(4-methylpiperazin-1-yl)-5-oxo-4-[4-(triazol-1-yl)phenyl]pyrazin-2-yl]propyl]azanium |
|---|---|
| PubChem CID | 153362988 |
| Molecular Formula | C30H34FN8O+ |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | [(2R)-2-(4-fluorophenyl)cyclopropyl]methylidene-[3-[6-(4-methylpiperazin-1-yl)-5-oxo-4-[4-(triazol-1-yl)phenyl]pyrazin-2-yl]propyl]azanium |
| SMILES | CN1CCN(c2nc(CCC/[NH+]=C/C3C[C@H]3c3ccc(F)cc3)cn(-c3ccc(-n4ccnn4)cc3)c2=O)CC1 |
| InChI | InChI=1S/C30H33FN8O/c1-36-15-17-37(18-16-36)29-30(40)38(26-8-10-27(11-9-26)39-14-13-33-35-39)21-25(34-29)3-2-12-32-20-23-19-28(23)22-4-6-24(31)7-5-22/h4-11,13-14,20-21,23,28H,2-3,12,15-19H2,1H3/p+1/b32-20+/t23?,28-/m0/s1 |
| InChIKey | XZFQKMLZCJEEKO-OJHSVTEFSA-O |
| XLogP | 1.59 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|