C21H32N6O3S — CID 153362983
N,N-dimethyl-4-[5-[3-(methylamino)propyl]-3-(4-methylpiperazin-1-yl)-2-oxopyrazin-1-yl]benzenesulfonamide (PubChem CID 153362983) has the molecular formula C21H32N6O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is N,N-dimethyl-4-[5-[3-(methylamino)propyl]-3-(4-methylpiperazin-1-yl)-2-oxopyrazin-1-yl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[5-[3-(methylamino)propyl]-3-(4-methylpiperazin-1-yl)-2-oxopyrazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 153362983 |
| Molecular Formula | C21H32N6O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | N,N-dimethyl-4-[5-[3-(methylamino)propyl]-3-(4-methylpiperazin-1-yl)-2-oxopyrazin-1-yl]benzenesulfonamide |
| SMILES | CNCCCc1cn(-c2ccc(S(=O)(=O)N(C)C)cc2)c(=O)c(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C21H32N6O3S/c1-22-11-5-6-17-16-27(18-7-9-19(10-8-18)31(29,30)24(2)3)21(28)20(23-17)26-14-12-25(4)13-15-26/h7-10,16,22H,5-6,11-15H2,1-4H3 |
| InChIKey | IXDXXQAKTFYXDU-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|