C20H25FN4O3 — CID 146242982
ethyl 3-[4-(4-fluorophenyl)-6-(4-methylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanoate (PubChem CID 146242982) has the molecular formula C20H25FN4O3 and a molecular weight of 388.44 g/mol. Its IUPAC name is ethyl 3-[4-(4-fluorophenyl)-6-(4-methylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanoate.
| Compound Name | ethyl 3-[4-(4-fluorophenyl)-6-(4-methylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanoate |
|---|---|
| PubChem CID | 146242982 |
| Molecular Formula | C20H25FN4O3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | ethyl 3-[4-(4-fluorophenyl)-6-(4-methylpiperazin-1-yl)-5-oxopyrazin-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1cn(-c2ccc(F)cc2)c(=O)c(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C20H25FN4O3/c1-3-28-18(26)9-6-16-14-25(17-7-4-15(21)5-8-17)20(27)19(22-16)24-12-10-23(2)11-13-24/h4-5,7-8,14H,3,6,9-13H2,1-2H3 |
| InChIKey | PWZKZSCSTCWIER-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |