C21H29ClN6O3Si — CID 174107077
1-(2-chloro-7-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-4-yl)-3-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione (PubChem CID 174107077) has the molecular formula C21H29ClN6O3Si and a molecular weight of 477.04 g/mol. Its IUPAC name is 1-(2-chloro-7-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-4-yl)-3-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(2-chloro-7-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-4-yl)-3-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174107077 |
| Molecular Formula | C21H29ClN6O3Si |
| Molecular Weight | 477.04 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 1-(2-chloro-7-piperidin-4-ylpyrrolo[2,3-d]pyrimidin-4-yl)-3-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione |
| SMILES | C[Si](C)(C)CCOCn1c(=O)ccn(-c2nc(Cl)nc3c2ccn3C2CCNCC2)c1=O |
| InChI | InChI=1S/C21H29ClN6O3Si/c1-32(2,3)13-12-31-14-28-17(29)7-11-27(21(28)30)19-16-6-10-26(15-4-8-23-9-5-15)18(16)24-20(22)25-19/h6-7,10-11,15,23H,4-5,8-9,12-14H2,1-3H3 |
| InChIKey | YYCGPAJJTYTVHV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 95.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.04 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|