C18H29ClN4O3Si — CID 151051356
6-chloro-3-[(4-hydroxypiperidin-4-yl)methyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 151051356) has the molecular formula C18H29ClN4O3Si and a molecular weight of 412.99 g/mol. Its IUPAC name is 6-chloro-3-[(4-hydroxypiperidin-4-yl)methyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 6-chloro-3-[(4-hydroxypiperidin-4-yl)methyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 151051356 |
| Molecular Formula | C18H29ClN4O3Si |
| Molecular Weight | 412.99 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 6-chloro-3-[(4-hydroxypiperidin-4-yl)methyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | C[Si](C)(C)CCOCn1c(Cl)cc2c(=O)n(CC3(O)CCNCC3)cnc21 |
| InChI | InChI=1S/C18H29ClN4O3Si/c1-27(2,3)9-8-26-13-23-15(19)10-14-16(23)21-12-22(17(14)24)11-18(25)4-6-20-7-5-18/h10,12,20,25H,4-9,11,13H2,1-3H3 |
| InChIKey | MEEOEPMCJOGECX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.99 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|