C25H33N5O3Si — CID 70650272
5-(6-methylimidazo[1,2-a]pyridin-3-yl)-3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-one (PubChem CID 70650272) has the molecular formula C25H33N5O3Si and a molecular weight of 479.66 g/mol. Its IUPAC name is 5-(6-methylimidazo[1,2-a]pyridin-3-yl)-3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-one.
| Compound Name | 5-(6-methylimidazo[1,2-a]pyridin-3-yl)-3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 70650272 |
| Molecular Formula | C25H33N5O3Si |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 5-(6-methylimidazo[1,2-a]pyridin-3-yl)-3-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-one |
| SMILES | Cc1ccc2ncc(-c3ccc4c(n3)n(C3CCOCC3)c(=O)n4COCC[Si](C)(C)C)n2c1 |
| InChI | InChI=1S/C25H33N5O3Si/c1-18-5-8-23-26-15-22(28(23)16-18)20-6-7-21-24(27-20)30(19-9-11-32-12-10-19)25(31)29(21)17-33-13-14-34(2,3)4/h5-8,15-16,19H,9-14,17H2,1-4H3 |
| InChIKey | VSULHMOBMMZTFV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|