C23H33N5O2Si — CID 169097868
2-(6-methylpyrimidin-4-yl)-N-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-amine (PubChem CID 169097868) has the molecular formula C23H33N5O2Si and a molecular weight of 439.64 g/mol. Its IUPAC name is 2-(6-methylpyrimidin-4-yl)-N-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-amine.
| Compound Name | 2-(6-methylpyrimidin-4-yl)-N-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-amine |
|---|---|
| PubChem CID | 169097868 |
| Molecular Formula | C23H33N5O2Si |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 2-(6-methylpyrimidin-4-yl)-N-(oxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-amine |
| SMILES | Cc1cc(-c2cc3cnc(NC4CCOCC4)cc3n2COCC[Si](C)(C)C)ncn1 |
| InChI | InChI=1S/C23H33N5O2Si/c1-17-11-20(26-15-25-17)22-12-18-14-24-23(27-19-5-7-29-8-6-19)13-21(18)28(22)16-30-9-10-31(2,3)4/h11-15,19H,5-10,16H2,1-4H3,(H,24,27) |
| InChIKey | XJPFSVDLCJXYMQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|