C20H31N5OSi — CID 177245930
5-[(1-methylpiperidin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carbonitrile (PubChem CID 177245930) has the molecular formula C20H31N5OSi and a molecular weight of 385.59 g/mol. Its IUPAC name is 5-[(1-methylpiperidin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carbonitrile.
| Compound Name | 5-[(1-methylpiperidin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 177245930 |
| Molecular Formula | C20H31N5OSi |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 5-[(1-methylpiperidin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carbonitrile |
| SMILES | CN1CCC(Nc2cc3cc(C#N)n(COCC[Si](C)(C)C)c3cn2)CC1 |
| InChI | InChI=1S/C20H31N5OSi/c1-24-7-5-17(6-8-24)23-20-12-16-11-18(13-21)25(19(16)14-22-20)15-26-9-10-27(2,3)4/h11-12,14,17H,5-10,15H2,1-4H3,(H,22,23) |
| InChIKey | KQQLPTFIIWIZIS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|