C23H24N4O2 — CID 172598412
5-[(1-methylpiperidin-4-yl)amino]-3-[(Z)-3-phenoxyprop-2-enyl]furo[2,3-c]pyridine-2-carbonitrile (PubChem CID 172598412) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 5-[(1-methylpiperidin-4-yl)amino]-3-[(Z)-3-phenoxyprop-2-enyl]furo[2,3-c]pyridine-2-carbonitrile.
| Compound Name | 5-[(1-methylpiperidin-4-yl)amino]-3-[(Z)-3-phenoxyprop-2-enyl]furo[2,3-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 172598412 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 5-[(1-methylpiperidin-4-yl)amino]-3-[(Z)-3-phenoxyprop-2-enyl]furo[2,3-c]pyridine-2-carbonitrile |
| SMILES | CN1CCC(Nc2cc3c(C/C=C\Oc4ccccc4)c(C#N)oc3cn2)CC1 |
| InChI | InChI=1S/C23H24N4O2/c1-27-11-9-17(10-12-27)26-23-14-20-19(21(15-24)29-22(20)16-25-23)8-5-13-28-18-6-3-2-4-7-18/h2-7,13-14,16-17H,8-12H2,1H3,(H,25,26)/b13-5- |
| InChIKey | IDNWBWCPTNKAMH-ACAGNQJTSA-N |
| XLogP | 4.34 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|