C23H22N4O — CID 172599187
5-[(1-methylpiperidin-4-yl)amino]-3-(3-phenylprop-1-ynyl)furo[2,3-c]pyridine-2-carbonitrile (PubChem CID 172599187) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is 5-[(1-methylpiperidin-4-yl)amino]-3-(3-phenylprop-1-ynyl)furo[2,3-c]pyridine-2-carbonitrile.
| Compound Name | 5-[(1-methylpiperidin-4-yl)amino]-3-(3-phenylprop-1-ynyl)furo[2,3-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 172599187 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 5-[(1-methylpiperidin-4-yl)amino]-3-(3-phenylprop-1-ynyl)furo[2,3-c]pyridine-2-carbonitrile |
| SMILES | CN1CCC(Nc2cc3c(C#CCc4ccccc4)c(C#N)oc3cn2)CC1 |
| InChI | InChI=1S/C23H22N4O/c1-27-12-10-18(11-13-27)26-23-14-20-19(21(15-24)28-22(20)16-25-23)9-5-8-17-6-3-2-4-7-17/h2-4,6-7,14,16,18H,8,10-13H2,1H3,(H,25,26) |
| InChIKey | JRGFXEIJUQBSFC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|