C26H25N5O2 — CID 172598814
2-cyano-N-[cyano(phenyl)methyl]-5-[(4,6-dimethylcyclohept-3-en-1-yl)amino]furo[2,3-c]pyridine-3-carboxamide (PubChem CID 172598814) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-cyano-N-[cyano(phenyl)methyl]-5-[(4,6-dimethylcyclohept-3-en-1-yl)amino]furo[2,3-c]pyridine-3-carboxamide.
| Compound Name | 2-cyano-N-[cyano(phenyl)methyl]-5-[(4,6-dimethylcyclohept-3-en-1-yl)amino]furo[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172598814 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-cyano-N-[cyano(phenyl)methyl]-5-[(4,6-dimethylcyclohept-3-en-1-yl)amino]furo[2,3-c]pyridine-3-carboxamide |
| SMILES | CC1=CCC(Nc2cc3c(C(=O)NC(C#N)c4ccccc4)c(C#N)oc3cn2)CC(C)C1 |
| InChI | InChI=1S/C26H25N5O2/c1-16-8-9-19(11-17(2)10-16)30-24-12-20-23(15-29-24)33-22(14-28)25(20)26(32)31-21(13-27)18-6-4-3-5-7-18/h3-8,12,15,17,19,21H,9-11H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | AXFSJBLQQKZNHE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|