C31H41N5O3 — CID 172598207
ethane;4-(formamidomethyl)-N-methylbenzamide;3-methyl-5-[[(3Z)-8-methylcyclonon-3-en-1-yl]amino]furo[2,3-c]pyridine-2-carbonitrile (PubChem CID 172598207) has the molecular formula C31H41N5O3 and a molecular weight of 531.70 g/mol. Its IUPAC name is ethane;4-(formamidomethyl)-N-methylbenzamide;3-methyl-5-[[(3Z)-8-methylcyclonon-3-en-1-yl]amino]furo[2,3-c]pyridine-2-carbonitrile.
| Compound Name | ethane;4-(formamidomethyl)-N-methylbenzamide;3-methyl-5-[[(3Z)-8-methylcyclonon-3-en-1-yl]amino]furo[2,3-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 172598207 |
| Molecular Formula | C31H41N5O3 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | ethane;4-(formamidomethyl)-N-methylbenzamide;3-methyl-5-[[(3Z)-8-methylcyclonon-3-en-1-yl]amino]furo[2,3-c]pyridine-2-carbonitrile |
| SMILES | CC.CNC(=O)c1ccc(CNC=O)cc1.Cc1c(C#N)oc2cnc(NC3C/C=C\CCCC(C)C3)cc12 |
| InChI | InChI=1S/C19H23N3O.C10H12N2O2.C2H6/c1-13-7-5-3-4-6-8-15(9-13)22-19-10-16-14(2)17(11-20)23-18(16)12-21-19;1-11-10(14)9-4-2-8(3-5-9)6-12-7-13;1-2/h4,6,10,12-13,15H,3,5,7-9H2,1-2H3,(H,21,22);2-5,7H,6H2,1H3,(H,11,14)(H,12,13);1-2H3/b6-4-;; |
| InChIKey | HIXGAJGUGVLQBX-XFUGJFOESA-N |
| XLogP | 6.26 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|