C13H17N3 — CID 93287060
6-[[(1S,3R)-3-methylcyclohexyl]amino]pyridine-3-carbonitrile (PubChem CID 93287060) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 6-[[(1S,3R)-3-methylcyclohexyl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[(1S,3R)-3-methylcyclohexyl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 93287060 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 6-[[(1S,3R)-3-methylcyclohexyl]amino]pyridine-3-carbonitrile |
| SMILES | C[C@@H]1CCC[C@H](Nc2ccc(C#N)cn2)C1 |
| InChI | InChI=1S/C13H17N3/c1-10-3-2-4-12(7-10)16-13-6-5-11(8-14)9-15-13/h5-6,9-10,12H,2-4,7H2,1H3,(H,15,16)/t10-,12+/m1/s1 |
| InChIKey | AHQYOMGHFQAWQW-PWSUYJOCSA-N |
| XLogP | 2.94 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |