C20H29BrFN5OSi — CID 177245895
4-bromo-3-fluoro-5-[(1-methylpiperidin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carbonitrile (PubChem CID 177245895) has the molecular formula C20H29BrFN5OSi and a molecular weight of 482.47 g/mol. Its IUPAC name is 4-bromo-3-fluoro-5-[(1-methylpiperidin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carbonitrile.
| Compound Name | 4-bromo-3-fluoro-5-[(1-methylpiperidin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 177245895 |
| Molecular Formula | C20H29BrFN5OSi |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 4-bromo-3-fluoro-5-[(1-methylpiperidin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carbonitrile |
| SMILES | CN1CCC(Nc2ncc3c(c(F)c(C#N)n3COCC[Si](C)(C)C)c2Br)CC1 |
| InChI | InChI=1S/C20H29BrFN5OSi/c1-26-7-5-14(6-8-26)25-20-18(21)17-16(12-24-20)27(15(11-23)19(17)22)13-28-9-10-29(2,3)4/h12,14H,5-10,13H2,1-4H3,(H,24,25) |
| InChIKey | WWXDOVXAKLDTIA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|