C24H33N7O3SSi — CID 58177351
2-[2-[(1-methylsulfonylpiperidin-3-yl)amino]-3-pyridinyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbonitrile (PubChem CID 58177351) has the molecular formula C24H33N7O3SSi and a molecular weight of 527.73 g/mol. Its IUPAC name is 2-[2-[(1-methylsulfonylpiperidin-3-yl)amino]-3-pyridinyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbonitrile.
| Compound Name | 2-[2-[(1-methylsulfonylpiperidin-3-yl)amino]-3-pyridinyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbonitrile |
|---|---|
| PubChem CID | 58177351 |
| Molecular Formula | C24H33N7O3SSi |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 2-[2-[(1-methylsulfonylpiperidin-3-yl)amino]-3-pyridinyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(C#N)c2nc(-c3cccnc3NC3CCCN(S(C)(=O)=O)C3)cnc21 |
| InChI | InChI=1S/C24H33N7O3SSi/c1-35(32,33)31-10-6-7-19(16-31)28-23-20(8-5-9-26-23)21-14-27-24-22(29-21)18(13-25)15-30(24)17-34-11-12-36(2,3)4/h5,8-9,14-15,19H,6-7,10-12,16-17H2,1-4H3,(H,26,28) |
| InChIKey | RTRVCDLRAKADFC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 126.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|