C26H38N6O3SSi — CID 58177353
3-[7-cyclopropyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-N-(1-methylsulfonylpiperidin-3-yl)pyridin-2-amine (PubChem CID 58177353) has the molecular formula C26H38N6O3SSi and a molecular weight of 542.78 g/mol. Its IUPAC name is 3-[7-cyclopropyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-N-(1-methylsulfonylpiperidin-3-yl)pyridin-2-amine.
| Compound Name | 3-[7-cyclopropyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-N-(1-methylsulfonylpiperidin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 58177353 |
| Molecular Formula | C26H38N6O3SSi |
| Molecular Weight | 542.78 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 3-[7-cyclopropyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-N-(1-methylsulfonylpiperidin-3-yl)pyridin-2-amine |
| SMILES | C[Si](C)(C)CCOCn1cc(C2CC2)c2nc(-c3cccnc3NC3CCCN(S(C)(=O)=O)C3)cnc21 |
| InChI | InChI=1S/C26H38N6O3SSi/c1-36(33,34)32-12-6-7-20(16-32)29-25-21(8-5-11-27-25)23-15-28-26-24(30-23)22(19-9-10-19)17-31(26)18-35-13-14-37(2,3)4/h5,8,11,15,17,19-20H,6-7,9-10,12-14,16,18H2,1-4H3,(H,27,29) |
| InChIKey | OPQGRHPNFGHWBL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.78 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|