C20H31N5O2Si — CID 156708035
2-methoxy-7-(4-methylpiperazin-1-yl)-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile (PubChem CID 156708035) has the molecular formula C20H31N5O2Si and a molecular weight of 401.59 g/mol. Its IUPAC name is 2-methoxy-7-(4-methylpiperazin-1-yl)-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-methoxy-7-(4-methylpiperazin-1-yl)-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 156708035 |
| Molecular Formula | C20H31N5O2Si |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-methoxy-7-(4-methylpiperazin-1-yl)-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
| SMILES | COc1nc2c(N3CCN(C)CC3)cc(C#N)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H31N5O2Si/c1-23-6-8-24(9-7-23)17-12-16(14-21)13-18-19(17)22-20(26-2)25(18)15-27-10-11-28(3,4)5/h12-13H,6-11,15H2,1-5H3 |
| InChIKey | VBLFMOOWZIQTNA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|