C24H32N4O2Si — CID 140748572
2-[amino-(2-methoxy-4,6-dimethylphenyl)methyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile (PubChem CID 140748572) has the molecular formula C24H32N4O2Si and a molecular weight of 436.63 g/mol. Its IUPAC name is 2-[amino-(2-methoxy-4,6-dimethylphenyl)methyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-[amino-(2-methoxy-4,6-dimethylphenyl)methyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 140748572 |
| Molecular Formula | C24H32N4O2Si |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 2-[amino-(2-methoxy-4,6-dimethylphenyl)methyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
| SMILES | COc1cc(C)cc(C)c1C(N)c1nc2cc(C#N)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H32N4O2Si/c1-16-11-17(2)22(21(12-16)29-3)23(26)24-27-19-13-18(14-25)7-8-20(19)28(24)15-30-9-10-31(4,5)6/h7-8,11-13,23H,9-10,15,26H2,1-6H3 |
| InChIKey | KWMINQZQWGZAKM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|