C30H41N5O3SSi — CID 90057375
N-[1-[5-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-1-(5-methoxy-7-methyl-1H-indol-4-yl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 90057375) has the molecular formula C30H41N5O3SSi and a molecular weight of 579.84 g/mol. Its IUPAC name is N-[1-[5-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-1-(5-methoxy-7-methyl-1H-indol-4-yl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-[5-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-1-(5-methoxy-7-methyl-1H-indol-4-yl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 90057375 |
| Molecular Formula | C30H41N5O3SSi |
| Molecular Weight | 579.84 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | N-[1-[5-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-1-(5-methoxy-7-methyl-1H-indol-4-yl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | COc1cc(C)c2[nH]ccc2c1C(C)(NS(=O)C(C)(C)C)c1nc2cc(C#N)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C30H41N5O3SSi/c1-20-16-25(37-6)26(22-12-13-32-27(20)22)30(5,34-39(36)29(2,3)4)28-33-23-17-21(18-31)10-11-24(23)35(28)19-38-14-15-40(7,8)9/h10-13,16-17,32,34H,14-15,19H2,1-9H3 |
| InChIKey | RHMFXPRZCIEGHY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.84 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|