C34H40N4O4SSi — CID 90010617
2-[(5-ethyl-7-methyl-1H-indol-4-yl)-methoxy-(4-methylphenyl)sulfonylmethyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile (PubChem CID 90010617) has the molecular formula C34H40N4O4SSi and a molecular weight of 628.87 g/mol. Its IUPAC name is 2-[(5-ethyl-7-methyl-1H-indol-4-yl)-methoxy-(4-methylphenyl)sulfonylmethyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-[(5-ethyl-7-methyl-1H-indol-4-yl)-methoxy-(4-methylphenyl)sulfonylmethyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 90010617 |
| Molecular Formula | C34H40N4O4SSi |
| Molecular Weight | 628.87 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | 2-[(5-ethyl-7-methyl-1H-indol-4-yl)-methoxy-(4-methylphenyl)sulfonylmethyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
| SMILES | CCc1cc(C)c2[nH]ccc2c1C(OC)(c1nc2ccc(C#N)cc2n1COCC[Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H40N4O4SSi/c1-8-26-19-24(3)32-28(15-16-36-32)31(26)34(41-4,43(39,40)27-12-9-23(2)10-13-27)33-37-29-14-11-25(21-35)20-30(29)38(33)22-42-17-18-44(5,6)7/h9-16,19-20,36H,8,17-18,22H2,1-7H3 |
| InChIKey | VXSSVRBHIAQXKN-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.87 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|