C27H32N4O2Si — CID 90057009
2-[1-(5-ethoxy-7-methyl-1H-indol-4-yl)ethenyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile (PubChem CID 90057009) has the molecular formula C27H32N4O2Si and a molecular weight of 472.67 g/mol. Its IUPAC name is 2-[1-(5-ethoxy-7-methyl-1H-indol-4-yl)ethenyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-[1-(5-ethoxy-7-methyl-1H-indol-4-yl)ethenyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 90057009 |
| Molecular Formula | C27H32N4O2Si |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 2-[1-(5-ethoxy-7-methyl-1H-indol-4-yl)ethenyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
| SMILES | C=C(c1c(OCC)cc(C)c2[nH]ccc12)c1nc2ccc(C#N)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C27H32N4O2Si/c1-7-33-24-14-18(2)26-21(10-11-29-26)25(24)19(3)27-30-22-9-8-20(16-28)15-23(22)31(27)17-32-12-13-34(4,5)6/h8-11,14-15,29H,3,7,12-13,17H2,1-2,4-6H3 |
| InChIKey | SDLHOYLBHFDZQG-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|