C30H35F3N4O5Si — CID 90057038
ethyl 2-[1-[5-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-2,2,2-trifluoro-1-(5-methoxy-7-methyl-1H-indol-4-yl)ethoxy]acetate (PubChem CID 90057038) has the molecular formula C30H35F3N4O5Si and a molecular weight of 616.71 g/mol. Its IUPAC name is ethyl 2-[1-[5-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-2,2,2-trifluoro-1-(5-methoxy-7-methyl-1H-indol-4-yl)ethoxy]acetate.
| Compound Name | ethyl 2-[1-[5-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-2,2,2-trifluoro-1-(5-methoxy-7-methyl-1H-indol-4-yl)ethoxy]acetate |
|---|---|
| PubChem CID | 90057038 |
| Molecular Formula | C30H35F3N4O5Si |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | ethyl 2-[1-[5-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-2,2,2-trifluoro-1-(5-methoxy-7-methyl-1H-indol-4-yl)ethoxy]acetate |
| SMILES | CCOC(=O)COC(c1c(OC)cc(C)c2[nH]ccc12)(c1nc2cc(C#N)ccc2n1COCC[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C30H35F3N4O5Si/c1-7-41-25(38)17-42-29(30(31,32)33,26-21-10-11-35-27(21)19(2)14-24(26)39-3)28-36-22-15-20(16-34)8-9-23(22)37(28)18-40-12-13-43(4,5)6/h8-11,14-15,35H,7,12-13,17-18H2,1-6H3 |
| InChIKey | NNVYJUWIPBLBDZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|