C27H35N5O2Si — CID 90057383
2-[dimethylamino-(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile (PubChem CID 90057383) has the molecular formula C27H35N5O2Si and a molecular weight of 489.70 g/mol. Its IUPAC name is 2-[dimethylamino-(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-[dimethylamino-(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 90057383 |
| Molecular Formula | C27H35N5O2Si |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 2-[dimethylamino-(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
| SMILES | COc1cc(C)c2[nH]ccc2c1C(c1nc2ccc(C#N)cc2n1COCC[Si](C)(C)C)N(C)C |
| InChI | InChI=1S/C27H35N5O2Si/c1-18-14-23(33-4)24(20-10-11-29-25(18)20)26(31(2)3)27-30-21-9-8-19(16-28)15-22(21)32(27)17-34-12-13-35(5,6)7/h8-11,14-15,26,29H,12-13,17H2,1-7H3 |
| InChIKey | YJUPDSFMIJWLDJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|