C21H22N4O — CID 176667298
ethane;2-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]indazole-6-carbonitrile (PubChem CID 176667298) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is ethane;2-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]indazole-6-carbonitrile.
| Compound Name | ethane;2-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]indazole-6-carbonitrile |
|---|---|
| PubChem CID | 176667298 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | ethane;2-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]indazole-6-carbonitrile |
| SMILES | CC.COc1cc(C)c2[nH]ccc2c1Cn1cc2ccc(C#N)cc2n1 |
| InChI | InChI=1S/C19H16N4O.C2H6/c1-12-7-18(24-2)16(15-5-6-21-19(12)15)11-23-10-14-4-3-13(9-20)8-17(14)22-23;1-2/h3-8,10,21H,11H2,1-2H3;1-2H3 |
| InChIKey | ISKJXZKMGROEKD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |