C22H20N4O2S — CID 176667459
2-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-7-(thietan-3-yloxy)indazole-6-carbonitrile (PubChem CID 176667459) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-7-(thietan-3-yloxy)indazole-6-carbonitrile.
| Compound Name | 2-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-7-(thietan-3-yloxy)indazole-6-carbonitrile |
|---|---|
| PubChem CID | 176667459 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-7-(thietan-3-yloxy)indazole-6-carbonitrile |
| SMILES | COc1cc(C)c2[nH]ccc2c1Cn1cc2ccc(C#N)c(OC3CSC3)c2n1 |
| InChI | InChI=1S/C22H20N4O2S/c1-13-7-19(27-2)18(17-5-6-24-20(13)17)10-26-9-15-4-3-14(8-23)22(21(15)25-26)28-16-11-29-12-16/h3-7,9,16,24H,10-12H2,1-2H3 |
| InChIKey | QOBUNRZHAPZSBN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |