C26H32N2O3 — CID 166158520
benzoic acid;4-[(4-cyclopropylpiperidin-1-yl)methyl]-5-methoxy-7-methyl-1H-indole (PubChem CID 166158520) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is benzoic acid;4-[(4-cyclopropylpiperidin-1-yl)methyl]-5-methoxy-7-methyl-1H-indole.
| Compound Name | benzoic acid;4-[(4-cyclopropylpiperidin-1-yl)methyl]-5-methoxy-7-methyl-1H-indole |
|---|---|
| PubChem CID | 166158520 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | benzoic acid;4-[(4-cyclopropylpiperidin-1-yl)methyl]-5-methoxy-7-methyl-1H-indole |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1CCC(C2CC2)CC1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C19H26N2O.C7H6O2/c1-13-11-18(22-2)17(16-5-8-20-19(13)16)12-21-9-6-15(7-10-21)14-3-4-14;8-7(9)6-4-2-1-3-5-6/h5,8,11,14-15,20H,3-4,6-7,9-10,12H2,1-2H3;1-5H,(H,8,9) |
| InChIKey | YNGKNUAOPKDGAC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |