C24H28N2O3 — CID 90466744
4-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]azepan-2-yl]benzoic acid (PubChem CID 90466744) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]azepan-2-yl]benzoic acid.
| Compound Name | 4-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]azepan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 90466744 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 4-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]azepan-2-yl]benzoic acid |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1CCCCCC1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H28N2O3/c1-16-14-22(29-2)20(19-11-12-25-23(16)19)15-26-13-5-3-4-6-21(26)17-7-9-18(10-8-17)24(27)28/h7-12,14,21,25H,3-6,13,15H2,1-2H3,(H,27,28) |
| InChIKey | XYGTZXFQCWULFR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |