C22H25N3O3 — CID 166460827
4-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-2-yl]benzoic acid (PubChem CID 166460827) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-2-yl]benzoic acid.
| Compound Name | 4-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 166460827 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-2-yl]benzoic acid |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1CCNCC1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-14-11-20(28-2)18(17-7-8-24-21(14)17)13-25-10-9-23-12-19(25)15-3-5-16(6-4-15)22(26)27/h3-8,11,19,23-24H,9-10,12-13H2,1-2H3,(H,26,27) |
| InChIKey | GUBABBKCQNVCNG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |