C23H29N3O3 — CID 166460978
5-methoxy-7-methyl-4-(piperazin-1-ylmethyl)-1H-indole;methyl benzoate (PubChem CID 166460978) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 5-methoxy-7-methyl-4-(piperazin-1-ylmethyl)-1H-indole;methyl benzoate.
| Compound Name | 5-methoxy-7-methyl-4-(piperazin-1-ylmethyl)-1H-indole;methyl benzoate |
|---|---|
| PubChem CID | 166460978 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 5-methoxy-7-methyl-4-(piperazin-1-ylmethyl)-1H-indole;methyl benzoate |
| SMILES | COC(=O)c1ccccc1.COc1cc(C)c2[nH]ccc2c1CN1CCNCC1 |
| InChI | InChI=1S/C15H21N3O.C8H8O2/c1-11-9-14(19-2)13(12-3-4-17-15(11)12)10-18-7-5-16-6-8-18;1-10-8(9)7-5-3-2-4-6-7/h3-4,9,16-17H,5-8,10H2,1-2H3;2-6H,1H3 |
| InChIKey | FYERFNSXYKMUAJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |