C31H40N4O3 — CID 166461051
benzoic acid;(2Z,4E)-1-[4-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-1-yl]-N,5-dimethylhepta-2,4-dien-1-imine (PubChem CID 166461051) has the molecular formula C31H40N4O3 and a molecular weight of 516.69 g/mol. Its IUPAC name is benzoic acid;(2Z,4E)-1-[4-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-1-yl]-N,5-dimethylhepta-2,4-dien-1-imine.
| Compound Name | benzoic acid;(2Z,4E)-1-[4-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-1-yl]-N,5-dimethylhepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 166461051 |
| Molecular Formula | C31H40N4O3 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | benzoic acid;(2Z,4E)-1-[4-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-1-yl]-N,5-dimethylhepta-2,4-dien-1-imine |
| SMILES | CC/C(C)=C/C=C\C(=N\C)N1CCN(Cc2c(OC)cc(C)c3[nH]ccc23)CC1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C24H34N4O.C7H6O2/c1-6-18(2)8-7-9-23(25-4)28-14-12-27(13-15-28)17-21-20-10-11-26-24(20)19(3)16-22(21)29-5;8-7(9)6-4-2-1-3-5-6/h7-11,16,26H,6,12-15,17H2,1-5H3;1-5H,(H,8,9)/b9-7-,18-8+,25-23-; |
| InChIKey | UKGPJNMIULRYCW-YUEIJHAMSA-N |
| XLogP | 5.93 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|