C26H36F2N4O3 — CID 171840343
2-aminobenzoic acid;4-[[4-(2,2-difluoroethyl)piperazin-1-yl]methyl]-5-methoxy-7-methyl-1H-indole;ethane (PubChem CID 171840343) has the molecular formula C26H36F2N4O3 and a molecular weight of 490.60 g/mol. Its IUPAC name is 2-aminobenzoic acid;4-[[4-(2,2-difluoroethyl)piperazin-1-yl]methyl]-5-methoxy-7-methyl-1H-indole;ethane.
| Compound Name | 2-aminobenzoic acid;4-[[4-(2,2-difluoroethyl)piperazin-1-yl]methyl]-5-methoxy-7-methyl-1H-indole;ethane |
|---|---|
| PubChem CID | 171840343 |
| Molecular Formula | C26H36F2N4O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 2-aminobenzoic acid;4-[[4-(2,2-difluoroethyl)piperazin-1-yl]methyl]-5-methoxy-7-methyl-1H-indole;ethane |
| SMILES | CC.COc1cc(C)c2[nH]ccc2c1CN1CCN(CC(F)F)CC1.Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C17H23F2N3O.C7H7NO2.C2H6/c1-12-9-15(23-2)14(13-3-4-20-17(12)13)10-21-5-7-22(8-6-21)11-16(18)19;8-6-4-2-1-3-5(6)7(9)10;1-2/h3-4,9,16,20H,5-8,10-11H2,1-2H3;1-4H,8H2,(H,9,10);1-2H3 |
| InChIKey | VORVGDPZQVJXDJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|