C24H27F3N4O3 — CID 171840454
2-amino-4-[(2S)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoic acid (PubChem CID 171840454) has the molecular formula C24H27F3N4O3 and a molecular weight of 476.50 g/mol. Its IUPAC name is 2-amino-4-[(2S)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoic acid.
| Compound Name | 2-amino-4-[(2S)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 171840454 |
| Molecular Formula | C24H27F3N4O3 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 2-amino-4-[(2S)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoic acid |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1CCN(CC(F)(F)F)C[C@@H]1c1ccc(C(=O)O)c(N)c1 |
| InChI | InChI=1S/C24H27F3N4O3/c1-14-9-21(34-2)18(16-5-6-29-22(14)16)11-31-8-7-30(13-24(25,26)27)12-20(31)15-3-4-17(23(32)33)19(28)10-15/h3-6,9-10,20,29H,7-8,11-13,28H2,1-2H3,(H,32,33)/t20-/m1/s1 |
| InChIKey | ZKRQGMIUSCTPPU-HXUWFJFHSA-N |
| XLogP | 4.19 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|