C24H31N4O5+ — CID 166460849
dihydroxy-[3-(4-methoxycarbonylphenyl)-4-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-1-yl]-methylazanium (PubChem CID 166460849) has the molecular formula C24H31N4O5+ and a molecular weight of 455.54 g/mol. Its IUPAC name is dihydroxy-[3-(4-methoxycarbonylphenyl)-4-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-1-yl]-methylazanium.
| Compound Name | dihydroxy-[3-(4-methoxycarbonylphenyl)-4-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-1-yl]-methylazanium |
|---|---|
| PubChem CID | 166460849 |
| Molecular Formula | C24H31N4O5+ |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | dihydroxy-[3-(4-methoxycarbonylphenyl)-4-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-1-yl]-methylazanium |
| SMILES | COC(=O)c1ccc(C2CN([N+](C)(O)O)CCN2Cc2c(OC)cc(C)c3[nH]ccc23)cc1 |
| InChI | InChI=1S/C24H31N4O5/c1-16-13-22(32-3)20(19-9-10-25-23(16)19)14-26-11-12-27(28(2,30)31)15-21(26)17-5-7-18(8-6-17)24(29)33-4/h5-10,13,21,25,30-31H,11-12,14-15H2,1-4H3/q+1 |
| InChIKey | QJFIXOJMMSHPTD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|