C25H29N3O4 — CID 171840789
4-[8-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-7-yl]benzoic acid (PubChem CID 171840789) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 4-[8-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-7-yl]benzoic acid.
| Compound Name | 4-[8-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-7-yl]benzoic acid |
|---|---|
| PubChem CID | 171840789 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 4-[8-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-7-yl]benzoic acid |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1CC2COCCN2CC1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H29N3O4/c1-16-11-23(31-2)21(20-7-8-26-24(16)20)13-28-12-19-15-32-10-9-27(19)14-22(28)17-3-5-18(6-4-17)25(29)30/h3-8,11,19,22,26H,9-10,12-15H2,1-2H3,(H,29,30) |
| InChIKey | ZECUTQCNZVPDOS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |