C28H33N3O3 — CID 178167237
4-[(1S,2S,6R,10S)-11-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-8,11-diazatricyclo[6.4.0.02,6]dodecan-10-yl]benzoic acid (PubChem CID 178167237) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is 4-[(1S,2S,6R,10S)-11-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-8,11-diazatricyclo[6.4.0.02,6]dodecan-10-yl]benzoic acid.
| Compound Name | 4-[(1S,2S,6R,10S)-11-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-8,11-diazatricyclo[6.4.0.02,6]dodecan-10-yl]benzoic acid |
|---|---|
| PubChem CID | 178167237 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 4-[(1S,2S,6R,10S)-11-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-8,11-diazatricyclo[6.4.0.02,6]dodecan-10-yl]benzoic acid |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1C[C@@H]2[C@H]3CCC[C@H]3CN2C[C@@H]1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H33N3O3/c1-17-12-26(34-2)23(22-10-11-29-27(17)22)14-31-16-25-21-5-3-4-20(21)13-30(25)15-24(31)18-6-8-19(9-7-18)28(32)33/h6-12,20-21,24-25,29H,3-5,13-16H2,1-2H3,(H,32,33)/t20-,21-,24+,25+/m0/s1 |
| InChIKey | UXIKOPRDDYUCJG-KXTAGPOFSA-N |
| XLogP | 4.84 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |