C28H33N3O3 — CID 178167246
4-[(1R,2S,4R,8R)-9-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3,3-dimethyl-6,9-diazatricyclo[4.4.0.02,4]decan-8-yl]benzoic acid (PubChem CID 178167246) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is 4-[(1R,2S,4R,8R)-9-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3,3-dimethyl-6,9-diazatricyclo[4.4.0.02,4]decan-8-yl]benzoic acid.
| Compound Name | 4-[(1R,2S,4R,8R)-9-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3,3-dimethyl-6,9-diazatricyclo[4.4.0.02,4]decan-8-yl]benzoic acid |
|---|---|
| PubChem CID | 178167246 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 4-[(1R,2S,4R,8R)-9-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3,3-dimethyl-6,9-diazatricyclo[4.4.0.02,4]decan-8-yl]benzoic acid |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1C[C@H]2[C@H]3[C@@H](CN2C[C@H]1c1ccc(C(=O)O)cc1)C3(C)C |
| InChI | InChI=1S/C28H33N3O3/c1-16-11-24(34-4)20(19-9-10-29-26(16)19)12-30-15-23-25-21(28(25,2)3)13-31(23)14-22(30)17-5-7-18(8-6-17)27(32)33/h5-11,21-23,25,29H,12-15H2,1-4H3,(H,32,33)/t21-,22+,23+,25-/m1/s1 |
| InChIKey | HHDJJFFELSJINY-KNAFXUBQSA-N |
| XLogP | 4.70 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |