C26H27F2N3O3 — CID 178167261
4-[(1S,2S,4R,8R)-3,3-difluoro-9-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-6,9-diazatricyclo[4.4.0.02,4]decan-8-yl]benzoic acid (PubChem CID 178167261) has the molecular formula C26H27F2N3O3 and a molecular weight of 467.52 g/mol. Its IUPAC name is 4-[(1S,2S,4R,8R)-3,3-difluoro-9-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-6,9-diazatricyclo[4.4.0.02,4]decan-8-yl]benzoic acid.
| Compound Name | 4-[(1S,2S,4R,8R)-3,3-difluoro-9-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-6,9-diazatricyclo[4.4.0.02,4]decan-8-yl]benzoic acid |
|---|---|
| PubChem CID | 178167261 |
| Molecular Formula | C26H27F2N3O3 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 4-[(1S,2S,4R,8R)-3,3-difluoro-9-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-6,9-diazatricyclo[4.4.0.02,4]decan-8-yl]benzoic acid |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1C[C@@H]2[C@@H]3[C@H](CN2C[C@H]1c1ccc(C(=O)O)cc1)C3(F)F |
| InChI | InChI=1S/C26H27F2N3O3/c1-14-9-22(34-2)18(17-7-8-29-24(14)17)10-30-13-21-23-19(26(23,27)28)11-31(21)12-20(30)15-3-5-16(6-4-15)25(32)33/h3-9,19-21,23,29H,10-13H2,1-2H3,(H,32,33)/t19-,20-,21+,23-/m0/s1 |
| InChIKey | CPMPFCSEKAARMC-QXUYBEEESA-N |
| XLogP | 4.31 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |