C27H33N3O2 — CID 166460836
5-methoxy-4-[[2-[4-(1-methoxyethenyl)phenyl]-4-prop-2-enylpiperazin-1-yl]methyl]-7-methyl-1H-indole (PubChem CID 166460836) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 5-methoxy-4-[[2-[4-(1-methoxyethenyl)phenyl]-4-prop-2-enylpiperazin-1-yl]methyl]-7-methyl-1H-indole.
| Compound Name | 5-methoxy-4-[[2-[4-(1-methoxyethenyl)phenyl]-4-prop-2-enylpiperazin-1-yl]methyl]-7-methyl-1H-indole |
|---|---|
| PubChem CID | 166460836 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 5-methoxy-4-[[2-[4-(1-methoxyethenyl)phenyl]-4-prop-2-enylpiperazin-1-yl]methyl]-7-methyl-1H-indole |
| SMILES | C=CCN1CCN(Cc2c(OC)cc(C)c3[nH]ccc23)C(c2ccc(C(=C)OC)cc2)C1 |
| InChI | InChI=1S/C27H33N3O2/c1-6-13-29-14-15-30(25(18-29)22-9-7-21(8-10-22)20(3)31-4)17-24-23-11-12-28-27(23)19(2)16-26(24)32-5/h6-12,16,25,28H,1,3,13-15,17-18H2,2,4-5H3 |
| InChIKey | TWOKFJXBWJZVGP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 40.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|