C25H30N3O2S+ — CID 174347382
[4-[(2R)-4-(cyclopropylmethyl)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-2-yl]phenyl]-oxosulfanium (PubChem CID 174347382) has the molecular formula C25H30N3O2S+ and a molecular weight of 436.60 g/mol. Its IUPAC name is [4-[(2R)-4-(cyclopropylmethyl)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-2-yl]phenyl]-oxosulfanium.
| Compound Name | [4-[(2R)-4-(cyclopropylmethyl)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-2-yl]phenyl]-oxosulfanium |
|---|---|
| PubChem CID | 174347382 |
| Molecular Formula | C25H30N3O2S+ |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [4-[(2R)-4-(cyclopropylmethyl)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperazin-2-yl]phenyl]-oxosulfanium |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1CCN(CC2CC2)C[C@H]1c1ccc([S+]=O)cc1 |
| InChI | InChI=1S/C25H30N3O2S/c1-17-13-24(30-2)22(21-9-10-26-25(17)21)15-28-12-11-27(14-18-3-4-18)16-23(28)19-5-7-20(31-29)8-6-19/h5-10,13,18,23,26H,3-4,11-12,14-16H2,1-2H3/q+1/t23-/m0/s1 |
| InChIKey | WQIGTXMRGBGIRN-QHCPKHFHSA-N |
| XLogP | 4.54 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|