C20H28N2O — CID 174347955
4-[(4-cyclopropyl-4-methylpiperidin-1-yl)methyl]-5-methoxy-7-methyl-1H-indole (PubChem CID 174347955) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 4-[(4-cyclopropyl-4-methylpiperidin-1-yl)methyl]-5-methoxy-7-methyl-1H-indole.
| Compound Name | 4-[(4-cyclopropyl-4-methylpiperidin-1-yl)methyl]-5-methoxy-7-methyl-1H-indole |
|---|---|
| PubChem CID | 174347955 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 4-[(4-cyclopropyl-4-methylpiperidin-1-yl)methyl]-5-methoxy-7-methyl-1H-indole |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1CCC(C)(C2CC2)CC1 |
| InChI | InChI=1S/C20H28N2O/c1-14-12-18(23-3)17(16-6-9-21-19(14)16)13-22-10-7-20(2,8-11-22)15-4-5-15/h6,9,12,15,21H,4-5,7-8,10-11,13H2,1-3H3 |
| InChIKey | XFUUGLISFMOPKY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |