C20H17N3O — CID 141393467
2-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-1H-indole-5-carbonitrile (PubChem CID 141393467) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-1H-indole-5-carbonitrile.
| Compound Name | 2-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 141393467 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-1H-indole-5-carbonitrile |
| SMILES | COc1cc(C)c2[nH]ccc2c1Cc1cc2cc(C#N)ccc2[nH]1 |
| InChI | InChI=1S/C20H17N3O/c1-12-7-19(24-2)17(16-5-6-22-20(12)16)10-15-9-14-8-13(11-21)3-4-18(14)23-15/h3-9,22-23H,10H2,1-2H3 |
| InChIKey | JZIBSKOLJIVLND-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |