C21H21N5O4 — CID 123440574
2-[1-[amino(dihydroxy)methoxy]-1-(5-methoxy-7-methyl-1H-indol-4-yl)ethyl]-3H-benzimidazole-5-carbonitrile (PubChem CID 123440574) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is 2-[1-[amino(dihydroxy)methoxy]-1-(5-methoxy-7-methyl-1H-indol-4-yl)ethyl]-3H-benzimidazole-5-carbonitrile.
| Compound Name | 2-[1-[amino(dihydroxy)methoxy]-1-(5-methoxy-7-methyl-1H-indol-4-yl)ethyl]-3H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 123440574 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-[1-[amino(dihydroxy)methoxy]-1-(5-methoxy-7-methyl-1H-indol-4-yl)ethyl]-3H-benzimidazole-5-carbonitrile |
| SMILES | COc1cc(C)c2[nH]ccc2c1C(C)(OC(N)(O)O)c1nc2ccc(C#N)cc2[nH]1 |
| InChI | InChI=1S/C21H21N5O4/c1-11-8-16(29-3)17(13-6-7-24-18(11)13)20(2,30-21(23,27)28)19-25-14-5-4-12(10-22)9-15(14)26-19/h4-9,24,27-28H,23H2,1-3H3,(H,25,26) |
| InChIKey | VDTXREYOEQJLDR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 153.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|